CymitQuimica logo

CAS 218594-84-4

:

ethyl (3S)-morpholine-3-carboxylate hydrochloride

Description:
Ethyl (3S)-morpholine-3-carboxylate hydrochloride is a chemical compound characterized by its morpholine ring structure, which contributes to its unique properties. This compound features a carboxylate functional group, indicating it is an ester, and the presence of a hydrochloride suggests it is a salt formed with hydrochloric acid. The "3S" designation indicates the specific stereochemistry at the third carbon of the morpholine ring, which can influence its biological activity and interactions. Ethyl (3S)-morpholine-3-carboxylate hydrochloride is typically a white to off-white crystalline solid, soluble in water and various organic solvents, making it useful in pharmaceutical applications. Its molecular structure allows for potential interactions with biological targets, which may be of interest in drug development. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C7H14ClNO3
InChI:InChI=1/C7H13NO3.ClH/c1-2-11-7(9)6-5-10-4-3-8-6;/h6,8H,2-5H2,1H3;1H/t6-;/m0./s1
InChI key:RERWECVXIGGYMH-RGMNGODLSA-N
SMILES:CCOC(=O)[C@@H]1COCCN1.Cl
Synonyms:
  • (S)-Ethyl Morpholine-3-Carboxylate Hydrochloride
Found 4 products.