
CAS 218601-62-8
:(2Z,3Z)-2,3-Bis[amino[(2-aminophenyl)thio]methylene]butanedinitrile
Description:
The chemical substance known as (2Z,3Z)-2,3-Bis[amino[(2-aminophenyl)thio]methylene]butanedinitrile, with the CAS number 218601-62-8, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including amino, thioether, and nitrile groups, which contribute to its reactivity and potential applications in various fields, such as medicinal chemistry and materials science. The presence of the thioether linkage suggests potential for interactions with biological systems, while the dinitrile groups may impart specific electronic properties. The stereochemistry indicated by the (2Z,3Z) configuration suggests that the compound has specific geometric isomerism, which can influence its biological activity and physical properties. Overall, this compound's intricate structure and functional diversity make it a subject of interest for further research, particularly in the development of novel therapeutic agents or materials with tailored properties.
Formula:C18H16N6S2
InChI:InChI=1S/C18H16N6S2/c19-9-11(17(23)25-15-7-3-1-5-13(15)21)12(10-20)18(24)26-16-8-4-2-6-14(16)22/h1-8H,21-24H2/b17-11+,18-12+
InChI key:InChIKey=DVEXZJFMOKTQEZ-JYFOCSDGSA-N
SMILES:C(\C(=C(\SC1=C(N)C=CC=C1)/N)\C#N)(=C(/SC2=C(N)C=CC=C2)\N)/C#N
Synonyms:- Butanedinitrile, 2,3-bis[amino[(2-aminophenyl)thio]methylene]-, (2Z,3Z)-
- (2Z,3Z)-2,3-Bis[amino[(2-aminophenyl)thio]methylene]butanedinitrile
- Butanedinitrile, bis[amino[(2-aminophenyl)thio]methylene]-, (2Z,3Z)-
- FT 1069-1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(2Z,3Z)-U0126
CAS:U0126 selectively inhibits MEK1/2, blocks MAPK/ERK signaling, and suppresses Ki-ras-induced cell growth, with IC50s of 72 nM and 58 nM for MEK1/2.Formula:C18H16N6S2Color and Shape:SolidMolecular weight:380.49
