CAS 218608-81-2
:(S)-3-Amino-5,5-dimethylhexanoic acid
Description:
(S)-3-Amino-5,5-dimethylhexanoic acid, also known as ADDA (Amino-Dimethyl-Dicarboxylic Acid), is an amino acid characterized by its chiral center, which gives rise to its specific stereochemistry. This compound features a branched-chain structure, with two methyl groups attached to the fifth carbon, contributing to its unique physical and chemical properties. It is a white crystalline solid that is soluble in water, making it suitable for various biochemical applications. The presence of both an amino group and a carboxylic acid group allows it to participate in typical amino acid reactions, such as peptide bond formation. This compound is of interest in pharmaceutical and biochemical research, particularly in the development of peptides and proteins. Its specific stereochemistry can influence biological activity, making it a valuable building block in drug design and synthesis. Additionally, its stability and solubility profile make it a candidate for various formulations in medicinal chemistry.
Formula:C8H17NO2
InChI:InChI=1/C8H17NO2/c1-8(2,3)5-6(9)4-7(10)11/h6H,4-5,9H2,1-3H3,(H,10,11)/t6-/m1/s1
SMILES:CC(C)(C)C[C@@H](CC(=O)O)N
Synonyms:- (3S)-3-Amino-5,5-dimethylhexanoic acid
- hexanoic acid, 3-amino-5,5-dimethyl-, (3S)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery