CymitQuimica logo

CAS 218631-44-8

:

1-(4-methoxyphenyl)-3-methyl-1H-pyrazole-5-carboxylic acid

Description:
1-(4-Methoxyphenyl)-3-methyl-1H-pyrazole-5-carboxylic acid, with the CAS number 218631-44-8, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methoxy group (-OCH3) attached to a phenyl ring, enhancing its lipophilicity and potentially influencing its biological activity. The presence of a carboxylic acid functional group (-COOH) contributes to its acidity and solubility in polar solvents, making it suitable for various applications in medicinal chemistry and drug development. The methyl group at the 3-position of the pyrazole ring may affect the compound's steric and electronic properties, influencing its reactivity and interaction with biological targets. Overall, this compound's unique structure suggests potential utility in pharmaceutical research, particularly in the development of new therapeutic agents. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in various chemical contexts.
Formula:C12H12N2O3
InChI:InChI=1/C12H12N2O3/c1-8-7-11(12(15)16)14(13-8)9-3-5-10(17-2)6-4-9/h3-7H,1-2H3,(H,15,16)
SMILES:Cc1cc(C(=O)O)n(c2ccc(cc2)OC)n1
Synonyms:
  • 1H-Pyrazole-5-carboxylic acid, 1-(4-methoxyphenyl)-3-methyl-
  • 3-Methyl-1-(4-methoxy phenyl)-pyrazole-5-carboxylic acid
  • 1-(4-Methoxyphenyl)-3-methyl-1H-pyrazole-5-carboxylic acid
Found 1 products.