CAS 218632-01-0
:3-Fluoro-4-nitrobenzonitrile
Description:
3-Fluoro-4-nitrobenzonitrile is an organic compound characterized by the presence of a fluorine atom, a nitro group, and a cyano group attached to a benzene ring. The molecular structure consists of a benzene ring substituted at the 3-position with a fluorine atom and at the 4-position with a nitro group, while the cyano group is attached to the benzene ring, typically at the 1-position. This compound is known for its potential applications in pharmaceuticals and agrochemicals due to the reactivity of the nitro and cyano groups, which can participate in various chemical reactions. It is generally a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the electronegative fluorine atom can influence the compound's electronic properties, making it a subject of interest in synthetic chemistry. Safety data should be consulted for handling, as compounds with nitro groups can be sensitive and require careful management in laboratory settings.
Formula:C7H3FN2O2
InChI:InChI=1/C7H3FN2O2/c8-6-3-5(4-9)1-2-7(6)10(11)12/h1-3H
SMILES:c1cc(c(cc1C#N)F)N(=O)=O
Synonyms:- Benzonitrile, 3-Fluoro-4-Nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzonitrile, 3-fluoro-4-nitro-
CAS:Formula:C7H3FN2O2Purity:97%Color and Shape:SolidMolecular weight:166.10933-Fluoro-4-nitrobenzonitrile
CAS:<p>3-Fluoro-4-nitrobenzonitrile</p>Formula:C7H3FN2O2Purity:≥95%Color and Shape: light yellow crystalline solidMolecular weight:166.11g/mol3-Fluoro-4-nitrobenzonitrile
CAS:Formula:C7H3FN2O2Purity:97%Color and Shape:SolidMolecular weight:166.1113-Fluoro-4-nitrobenzonitrile
CAS:<p>3-Fluoro-4-nitrobenzonitrile is a diamine that is activated by a nitro group and a halogen. It can be used as an intermediate in the synthesis of other chemicals, such as dyes, pharmaceuticals, and pesticides. 3-Fluoro-4-nitrobenzonitrile is also used to synthesize nitroaminobenzenes, which are converted to aminonitriles by reaction with ammonia. Nitro groups on 3-fluoro-4-nitrobenzonitrile react with alcohols to form nitrosamines. 3-Fluoro-4-nitrobenzonitrile has been shown to be effective in the treatment of angina pectoris and myocardial infarction due to its ability to dilate coronary arteries.</p>Formula:C7H3FN2O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:166.11 g/mol



