CymitQuimica logo

CAS 21874-50-0

:

Methyl 3-bromo-6-chloro-5-(dimethylamino)-2-pyrazinecarboxylate

Description:
Methyl 3-bromo-6-chloro-5-(dimethylamino)-2-pyrazinecarboxylate is a chemical compound characterized by its complex structure, which includes a pyrazine ring substituted with various functional groups. The presence of bromine and chlorine atoms indicates that it is a halogenated compound, which can influence its reactivity and biological activity. The dimethylamino group suggests potential basicity and nucleophilicity, making it a candidate for various chemical reactions, including those involving electrophiles. As a carboxylate ester, it may exhibit properties typical of esters, such as volatility and solubility in organic solvents. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could interact with biological targets. Additionally, its synthesis and handling would require standard laboratory safety protocols, given the presence of halogens and the potential for reactivity associated with the dimethylamino group. Overall, Methyl 3-bromo-6-chloro-5-(dimethylamino)-2-pyrazinecarboxylate represents a versatile compound with potential applications in various fields of chemistry.
Formula:C8H9BrClN3O2
InChI:InChI=1S/C8H9BrClN3O2/c1-13(2)7-6(10)11-4(5(9)12-7)8(14)15-3/h1-3H3
InChI key:InChIKey=XCWQNNKIXFHXQL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(Br)=NC(N(C)C)=C(Cl)N1
Synonyms:
  • Pyrazinecarboxylic acid, 3-bromo-6-chloro-5-(dimethylamino)-, methyl ester
  • Methyl 3-bromo-6-chloro-5-(dimethylamino)-2-pyrazinecarboxylate
  • 2-Pyrazinecarboxylic acid, 3-bromo-6-chloro-5-(dimethylamino)-, methyl ester
  • 3-Bromo-6-chloro-5-dimethylamino-pyrazine-2-carboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.