CymitQuimica logo

CAS 21879-83-4

:

4-deoxybostrycin

Description:
4-Deoxybostrycin is a naturally occurring compound classified as a polyketide, specifically a member of the anthracycline family. It is known for its complex structure, which includes multiple aromatic rings and hydroxyl groups, contributing to its biological activity. This compound exhibits notable antimicrobial and antitumor properties, making it of interest in pharmaceutical research. Its mechanism of action typically involves intercalation into DNA, disrupting replication and transcription processes in rapidly dividing cells. 4-Deoxybostrycin is often studied for its potential applications in cancer therapy, particularly due to its ability to target specific cancer cell lines. Additionally, the compound's solubility and stability in various solvents can influence its bioavailability and efficacy. As with many natural products, the extraction and purification processes can be challenging, necessitating advanced techniques in organic chemistry. Overall, 4-deoxybostrycin represents a significant area of study within medicinal chemistry, highlighting the importance of natural compounds in drug discovery and development.
Formula:C16H16O7
InChI:InChI=1/C16H16O7/c1-16(22)5-7-6(3-10(16)18)13(19)11-8(17)4-9(23-2)15(21)12(11)14(7)20/h4,10,18-20,22H,3,5H2,1-2H3/t10-,16+/m1/s1
Synonyms:
  • (6R,7S)-5,6,7,8-Tetrahydro-6,7,9,10-tetrahydroxy-2-methoxy-7-methyl-1,4-anthracenedione
  • 4-deoxybostrycin
  • 1-Deoxybostrycin
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.