
CAS 21888-96-0
:[3,4′-Bipiperidine]-2,6-dione, 3-phenyl-1′-(phenylmethyl)-, hydrochloride (1:1), (3S)-
Description:
[3,4′-Bipiperidine]-2,6-dione, 3-phenyl-1′-(phenylmethyl)-, hydrochloride (1:1), (3S)-, is a chemical compound characterized by its bipiperidine structure, which consists of two piperidine rings connected by a carbonyl group. This compound features a phenyl group and a phenylmethyl substituent, contributing to its complex aromatic character. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The (3S)- designation refers to the specific stereochemistry at the chiral center, which can influence the compound's biological activity and interactions. Generally, compounds of this nature may exhibit properties such as potential neuroactivity or utility in medicinal chemistry, although specific biological effects would depend on further empirical studies. As with many organic compounds, proper handling and storage are essential to maintain stability and prevent degradation.
Formula:C23H26N2O2·ClH
InChI:InChI=1S/C23H26N2O2.ClH/c26-21-11-14-23(22(27)24-21,19-9-5-2-6-10-19)20-12-15-25(16-13-20)17-18-7-3-1-4-8-18;/h1-10,20H,11-17H2,(H,24,26,27);1H/t23-;/m1./s1
InChI key:InChIKey=XSOOSXRNMDUWEM-GNAFDRTKSA-N
SMILES:O=C1[C@@](CCC(=O)N1)(C2CCN(CC3=CC=CC=C3)CC2)C4=CC=CC=C4.Cl
Synonyms:- [3,4′-Bipiperidine]-2,6-dione, 3-phenyl-1′-(phenylmethyl)-, monohydrochloride, (S)-
- [3,4′-Bipiperidine]-2,6-dione, 3-phenyl-1′-(phenylmethyl)-, hydrochloride (1:1), (3S)-
- Glutarimide, 2-(1-benzyl-4-piperidyl)-2-phenyl-, monohydrochloride, (S)-(+)-
- [3,4′-Bipiperidine]-2,6-dione, 3-phenyl-1′-(phenylmethyl)-, monohydrochloride, (3S)-
- (+)-Benzetimide hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dexetimide HCl
CAS:Dexetimide HCl is a muscarinic antagonist that has been used to treat neuroleptic-induced parkinsonism. Benzetimide is the (-)-enantimorph of dexetimide.Formula:C23H27ClN2O2Color and Shape:SolidMolecular weight:398.93
