CAS 21889-33-8
:dimethyl 4-(2-aminophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
Description:
Dimethyl 4-(2-aminophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate, identified by its CAS number 21889-33-8, is a chemical compound that belongs to the class of dihydropyridines, which are known for their diverse biological activities. This compound features a dihydropyridine core substituted with two carboxylate ester groups and an amino phenyl group, contributing to its potential pharmacological properties. The presence of the dimethyl groups enhances its lipophilicity, which may influence its absorption and distribution in biological systems. The amino group can participate in hydrogen bonding, potentially affecting its interaction with biological targets. Dihydropyridines are often studied for their role as calcium channel blockers and in various therapeutic applications, including cardiovascular and neurological disorders. The structural complexity of this compound suggests it may exhibit unique reactivity and stability characteristics, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific biological activities and potential applications.
Formula:C17H20N2O4
InChI:InChI=1/C17H20N2O4/c1-9-13(16(20)22-3)15(11-7-5-6-8-12(11)18)14(10(2)19-9)17(21)23-4/h5-8,15,19H,18H2,1-4H3
SMILES:CC1=C(C(c2ccccc2N)C(=C(C)N1)C(=O)OC)C(=O)OC
Synonyms:- 3,5-Pyridinedicarboxylic acid, 4-(2-aminophenyl)-1,4-dihydro-2,6-dimethyl-, dimethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dimethyl 1,4-Dihydro-2,6-dimethyl-4-(2'-aminophenyl)-pyridine-3,5-dicarboxylate
CAS:Controlled ProductApplications Dimethyl 1,4-Dihydro-2,6-dimethyl-4-(2’-aminophenyl)-pyridine-3,5-dicarboxylate (cas# 21889-33-8) is a compound useful in organic synthesis.
Formula:C17H20N2O4Color and Shape:NeatMolecular weight:316.35
