CAS 2189-60-8: Octylbenzene
Description:Octylbenzene, with the CAS number 2189-60-8, is an organic compound classified as an aromatic hydrocarbon. It consists of a benzene ring substituted with an octyl group, which is an alkyl chain containing eight carbon atoms. This compound is typically a colorless to pale yellow liquid with a characteristic aromatic odor. Octylbenzene is known for its hydrophobic nature, making it insoluble in water but soluble in organic solvents. It has a relatively high boiling point compared to many other hydrocarbons due to the presence of the aromatic ring, which contributes to its stability. Octylbenzene is primarily used as a solvent and in the production of various chemical intermediates. Additionally, it can serve as a component in formulations for lubricants and surfactants. While it is not widely studied for toxicity, like many aromatic compounds, it is advisable to handle it with care due to potential health risks associated with prolonged exposure. Overall, octylbenzene is a significant compound in industrial applications, particularly in organic synthesis and chemical manufacturing.
Formula:C14H22
InChI:InChI=1S/C14H22/c1-2-3-4-5-6-8-11-14-12-9-7-10-13-14/h7,9-10,12-13H,2-6,8,11H2,1H3
InChI key:InChIKey=CDKDZKXSXLNROY-UHFFFAOYSA-N
SMILES:C=1C=CC(=CC1)CCCCCCCC
- Synonyms:
- 1-Octylbenzene
- Benzene, octyl-
- NSC 404115
- Octane, 1-phenyl-
- Octylbenzene
- Octylbenzol
- n-Octylbenzene
- n-Octylbenzene, (1-Phenyloctane)
- 1-Phenyloctane
