
CAS 218921-06-3
:4-Methoxy-3,5-dimethyl-2-pyridineacetonitrile
Description:
4-Methoxy-3,5-dimethyl-2-pyridineacetonitrile is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of methoxy and dimethyl substituents on the pyridine ring contributes to its unique chemical properties. This compound typically exhibits moderate polarity due to the methoxy group, which can influence its solubility in various solvents. The acetonitrile functional group introduces a nitrile (-C≡N) moiety, which is known for its ability to participate in nucleophilic reactions and can serve as a versatile building block in organic synthesis. The compound may also display biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, and it may be used in the development of new therapeutic agents. Safety data and handling precautions should be considered, as with any chemical substance, particularly regarding its toxicity and environmental impact.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c1-7-6-12-9(4-5-11)8(2)10(7)13-3/h6H,4H2,1-3H3
InChI key:InChIKey=GYJNRAPPVNHXBA-UHFFFAOYSA-N
SMILES:O(C)C=1C(C)=C(CC#N)N=CC1C
Synonyms:- 2-Pyridineacetonitrile, 4-methoxy-3,5-dimethyl-
- 2-(4-Methoxy-3,5-dimethylpyridin-2-yl)acetonitrile
- 4-Methoxy-3,5-dimethyl-2-pyridineacetonitrile
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery