CAS 218930-20-2

N-(2,4-difluorophenyl)-3-oxobutanamide

Description:

N-(2,4-difluorophenyl)-3-oxobutanamide is an organic compound characterized by its amide functional group and a ketone moiety. The presence of the 2,4-difluorophenyl group indicates that the compound has two fluorine atoms substituted on a phenyl ring, which can influence its reactivity and physical properties, such as polarity and solubility. The 3-oxobutanamide structure suggests that it contains a butanamide backbone with a ketone at the third carbon, contributing to its potential biological activity. This compound may exhibit interesting pharmacological properties due to the presence of the fluorinated aromatic ring, which can enhance lipophilicity and metabolic stability. Its molecular interactions could be significant in medicinal chemistry, particularly in drug design. Additionally, the compound's stability, solubility, and reactivity can be influenced by the electronic effects of the fluorine substituents. Overall, N-(2,4-difluorophenyl)-3-oxobutanamide represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₁₀H₉F₂NO₂

InChI: InChI=1/C10H9F2NO2/c1-6(14)4-10(15)13-9-3-2-7(11)5-8(9)12/h2-3,5H,4H2,1H3,(H,13,15)

SMILES: CC(=O)CC(=Nc1ccc(cc1F)F)O

Synonyms:

• N1-(2,4-difluorophenyl)-3-oxobutanamide

N-(2,4-difluorophenyl)-3-oxobutanamide

CAS: 218930-20-2

Formula: C₁₀H₉F₂NO₂

Purity: 95.0%

Color and Shape: White powder

Molecular weight: 213.184

Ref: 10-F314795