CymitQuimica logo

CAS 218938-62-6

:

H-Tyr(tBu)-allyl ester . HCl

Description:
H-Tyr(tBu)-allyl ester.HCl, with the CAS number 218938-62-6, is a chemical compound that features a modified form of the amino acid tyrosine. The "H-Tyr" indicates that it is a histidine derivative where the amino group is protonated, while "tBu" refers to a tert-butyl group that is typically used to protect the hydroxyl group of tyrosine, enhancing its stability and solubility. The "allyl ester" portion signifies that the carboxylic acid group of tyrosine is esterified with an allyl alcohol, which can facilitate further chemical reactions, such as coupling or polymerization. The presence of hydrochloride (HCl) indicates that the compound is in its salt form, which can improve its solubility in water and biological systems. This compound is often utilized in peptide synthesis and other organic chemistry applications due to its functional groups that allow for selective reactions. Overall, H-Tyr(tBu)-allyl ester.HCl is characterized by its protective groups, solubility properties, and reactivity, making it a valuable intermediate in synthetic chemistry.
Formula:C16H23NO3.HCl
InChI:InChI=1S/C16H23NO3.ClH/c1-5-10-19-15(18)14(17)11-12-6-8-13(9-7-12)20-16(2,3)4;/h5-9,14H,1,10-11,17H2,2-4H3;1H/t14-;/m0./s1
InChI key:XUFOSDWVNYYLBH-UQKRIMTDSA-N
SMILES:CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)OCC=C)N.Cl
Found 2 products.