CymitQuimica logo

CAS 21894-06-4

:

1-Hydroxy-4-(4-nitrophenoxy)-2-naphthoic acid

Description:
1-Hydroxy-4-(4-nitrophenoxy)-2-naphthoic acid, with the CAS number 21894-06-4, is an organic compound characterized by its naphthalene structure, which is substituted with a hydroxyl group and a nitrophenoxy group. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in dye chemistry and as an intermediate in organic synthesis. The presence of the nitro group contributes to its electron-withdrawing characteristics, influencing its reactivity and solubility in various solvents. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting its physical properties and interactions with other molecules. The compound may also display UV-Vis absorbance characteristics due to its aromatic structure, making it useful in photochemical applications. Safety data should be consulted for handling, as compounds with nitro groups can pose health risks. Overall, 1-Hydroxy-4-(4-nitrophenoxy)-2-naphthoic acid is a notable compound in the realm of organic chemistry with specific functional groups that dictate its chemical behavior and potential uses.
Formula:C17H11NO6
InChI:InChI=1S/C17H11NO6/c19-16-13-4-2-1-3-12(13)15(9-14(16)17(20)21)24-11-7-5-10(6-8-11)18(22)23/h1-9,19H,(H,20,21)
InChI key:InChIKey=DBNQZGPCPCXGCX-UHFFFAOYSA-N
SMILES:O(C=1C2=C(C(O)=C(C(O)=O)C1)C=CC=C2)C3=CC=C(N(=O)=O)C=C3
Synonyms:
  • 1-Hydroxy-4-(4-Nitrophenoxy)Naphthalene-2-Carboxylic Acid
  • 1-Hydroxy-4-(4-nitrophenoxy)-2-naphthalenecarboxylic acid
  • 2-Naphthalenecarboxylic acid, 1-hydroxy-4-(4-nitrophenoxy)-
  • 2-Naphthoic acid, 1-hydroxy-4-(p-nitrophenoxy)-
  • 1-Hydroxy-4-(4-nitrophenoxy)-2-naphthoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.