CAS 218943-30-7
:Boc-L-beta-homoglutamic acid 6-benzyl ester
Description:
Boc-L-beta-homoglutamic acid 6-benzyl ester is a chemical compound that belongs to the class of amino acids and is characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group, which is commonly used in peptide synthesis to protect the amino group. This compound features a beta-homoglutamic acid backbone, which is an analog of glutamic acid with an additional methylene group in the side chain, enhancing its structural properties. The 6-benzyl ester moiety indicates that a benzyl group is esterified at the carboxylic acid position, contributing to its lipophilicity and potential applications in drug design and peptide synthesis. The compound is typically used in the synthesis of peptides and other bioactive molecules due to its ability to form stable linkages and its compatibility with various coupling reactions. Its unique structure allows for specific interactions in biological systems, making it a valuable intermediate in medicinal chemistry and biochemistry.
Formula:C18H25NO6
InChI:InChI=1/C18H25NO6/c1-18(2,3)25-17(23)19-14(11-15(20)21)9-10-16(22)24-12-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H,19,23)(H,20,21)/t14-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](CCC(=O)OCc1ccccc1)CC(=O)O)O
Synonyms:- Boc-L-beta-homoglutamic acid(OBzl)
- (3S)-6-(benzyloxy)-3-[(tert-butoxycarbonyl)amino]-6-oxohexanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-3-(Boc-amino)adipic acid 6-benzyl ester, 95%
CAS:Starting materials for peptide synthesis, peptidomimetic and medicinal chemistry, protected amino acids, coupling reagents, linkers and resins, natural and unusual amino acids and building blocks used in peptide synthesis, peptidomimetic and medicinal chemistry. Reagents for PEGylation, Life scienceFormula:C18H25NO6Purity:95%Molecular weight:351.4Boc-l-β-homoglutamic acid 6-benzyl ester
CAS:Formula:C18H25NO6Purity:98%Color and Shape:SolidMolecular weight:351.3942Boc-ß-HoGlu(OBzl)-OH
CAS:M06108 - Boc-ß-HoGlu(OBzl)-OH
Formula:C18H25NO6Purity:98%Molecular weight:351.399




