CAS 2190-18-3
:1,1′-[2-[(1-Oxooctadecyl)oxy]-1,3-propanediyl] di-9,12-octadecadienoate
Description:
1,1′-[2-[(1-Oxooctadecyl)oxy]-1,3-propanediyl] di-9,12-octadecadienoate, commonly known by its CAS number 2190-18-3, is a chemical compound that belongs to the class of esters. It is characterized by its long hydrocarbon chains, which contribute to its hydrophobic properties. The structure features a glycerol backbone with two octadecadienoate (a type of fatty acid) ester groups, indicating that it is a diester. This compound is typically derived from natural sources and may exhibit emulsifying properties, making it useful in various applications, including food, cosmetics, and pharmaceuticals. Its molecular structure suggests potential biological activity, and it may interact with lipid membranes due to its amphiphilic nature. Additionally, the presence of unsaturated fatty acid chains can influence its physical properties, such as melting point and solubility. Overall, this compound is of interest in both industrial and research settings, particularly in the study of lipid chemistry and formulation science.
Formula:C57H102O6
InChI:InChI=1S/C57H102O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h16-17,19-20,25-26,28-29,54H,4-15,18,21-24,27,30-53H2,1-3H3/b19-16-,20-17-,28-25-,29-26-
InChI key:InChIKey=FGNXNKQAEKNDNA-XEUHHCTMSA-N
SMILES:C(OC(CCCCCCCCCCCCCCCCC)=O)(COC(CCCCCCC/C=C\C/C=C\CCCCC)=O)COC(CCCCCCC/C=C\C/C=C\CCCCC)=O
Synonyms:- 9,12-Octadecadienoic acid (Z,Z)-, 2-[(1-oxooctadecyl)oxy]-1,3-propanediyl ester
- 1,1′-[2-[(1-Oxooctadecyl)oxy]-1,3-propanediyl] di-9,12-octadecadienoate
- 9,12-Octadecadienoic acid, 1,1′-[2-[(1-oxooctadecyl)oxy]-1,3-propanediyl] ester
- 9,12-Octadecadienoic acid (9Z,12Z)-, 2-[(1-oxooctadecyl)oxy]-1,3-propanediyl ester
- Linolein, 2-stearo-1,3-di-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,3-Linolein-2-stearin
CAS:<p>1,3-Linolein-2-stearin is a structured triglyceride, which is a type of lipid molecule composed of linoleic acid and stearic acid. It is typically synthesized in a laboratory setting by specific esterification processes. The compound's unique structure, featuring linoleic acid at the first and third positions and stearic acid at the second position, allows researchers to study various biochemical pathways and interactions.</p>Formula:C57H102O6Purity:Min. 95%Molecular weight:883.4 g/mol1,3-Dilinoleoyl-2-Stearoyl Glycerol
CAS:1,3-Dilinoleoyl-2-stearoyl glycerol, a triacylglycerol, incorporates linoleic acid at the sn-1 and sn-3 positions and stearic acid at the sn-2 position. This compound is present in soybean oil and both transitional and mature human milk.Formula:C57H102O6Color and Shape:SolidMolecular weight:883.4


