CAS 2190-30-9: 1,2-Dioleoyl-3-palmitoylglycerol
Description:1,2-Dioleoyl-3-palmitoylglycerol, commonly referred to as DOPG, is a glycerolipid characterized by its unique structure, which consists of two oleoyl (18-carbon unsaturated fatty acid) chains and one palmitoyl (16-carbon saturated fatty acid) chain esterified to a glycerol backbone. This compound is notable for its amphiphilic nature, allowing it to form lipid bilayers and micelles, which are essential in biological membranes and various biochemical applications. DOPG is often utilized in studies related to membrane dynamics, lipid bilayer formation, and drug delivery systems due to its ability to interact with proteins and other biomolecules. Its properties include a relatively high melting point compared to other glycerolipids, making it stable under physiological conditions. Additionally, DOPG can influence membrane fluidity and permeability, which are critical factors in cellular processes. The compound is also of interest in the field of nanotechnology and biochemistry for its potential applications in creating liposomes and other delivery vehicles for therapeutic agents.
Formula:C55H102O6
InChI:InChI=1/C55H102O6/c1-4-7-10-13-16-19-22-25-27-30-33-36-39-42-45-48-54(57)60-51-52(50-59-53(56)47-44-41-38-35-32-29-24-21-18-15-12-9-6-3)61-55(58)49-46-43-40-37-34-31-28-26-23-20-17-14-11-8-5-2/h25-28,52H,4-24,29-51H2,1-3H3/b27-25-,28-26-
InChI key:InChIKey=JFISYPWOVQNHLS-LBXGSASVNA-N
SMILES:O=C(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC)CCCCCCCC=CCCCCCCCC
- Synonyms:
- Olein, 3-palmito-1,2-di-
- 9-Octadecenoic acid (Z)-, 1-[[(1-oxohexadecyl)oxy]methyl]-1,2-ethanediyl ester
- 9-Octadecenoic acid (9Z)-, 1-[[(1-oxohexadecyl)oxy]methyl]-1,2-ethanediyl ester
- Palmitin, 2,3-dioleo-1-
- 9-Octadecenoic acid (9Z)-, 1,1′-[1-[[(1-oxohexadecyl)oxy]methyl]-1,2-ethanediyl] ester