CAS 21900-52-7
:5-Bromo-2-chlorobenzoyl chloride
Description:
5-Bromo-2-chlorobenzoyl chloride is an organic compound characterized by the presence of both bromine and chlorine substituents on a benzoyl chloride structure. It features a benzene ring with a carbonyl group (C=O) and a chlorine atom attached to the second carbon, while a bromine atom is located at the fifth position. This compound is typically used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, due to its reactivity as an acyl chloride. It is known for its electrophilic properties, making it a useful intermediate in acylation reactions. The presence of halogens enhances its reactivity, allowing for further functionalization. As with many halogenated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Safety precautions should be observed, as it can be corrosive and may cause irritation to skin and mucous membranes. Proper storage conditions are essential to maintain its stability and prevent degradation.
Formula:C7H3BrCl2O
InChI:InChI=1S/C7H3BrCl2O/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H
InChI key:InChIKey=TZIQQJRRMJWMDI-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(Cl)C=CC(Br)=C1
Synonyms:- Benzoyl chloride, 5-bromo-2-chloro-
- 5-Bromo-2-chlorobenzoyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-BROMO-2-CHLORO-BENZOYL CHLORIDE
CAS:Formula:C7H3BrCl2OPurity:97%Color and Shape:SolidMolecular weight:253.9081Dapagliflozin Impurity 55
CAS:Formula:C7H3BrCl2OColor and Shape:White To Off-White SolidMolecular weight:253.905-Bromo-2-chlorobenzoyl chloride
CAS:5-Bromo-2-chlorobenzoyl chloridePurity:95%Molecular weight:253.91g/mol5-Bromo-2-chlorobenzoyl Chloride
CAS:Controlled ProductFormula:C7H3BrCl2OColor and Shape:Off-WhiteMolecular weight:253.9085-Bromo-2-chloro-benzoyl chloride
CAS:Formula:C7H3BrCl2OPurity:97%Color and Shape:Solid, ClearMolecular weight:253.95-Bromo-2-chlorobenzoyl chloride
CAS:5-Bromo-2-chlorobenzoyl chloride is a chemical compound that is used as an intermediate for the production of compounds. It can be produced by the reaction of benzene with thionyl chloride in the presence of phenetole. The chemical reaction proceeds with high yield and utilizes a high concentration of benzene, which is a pollutant. The reaction yields a mixture of 5-bromo-2-chlorobenzoyl chloride and 2,4,6-trichlorobenzoyl chloride and utilizes an organic solvent such as formic acid or acetic acid to form 5-bromo-2,4,6-trichlorobenzoic acid in situ. 5-Bromo-2,4,6-trichlorobenzoic acid is then reacted with ammonia to produce 2-(5'-bromo)benzothiazole. This chemical compound has been used as a reagent
Formula:C7H3BrCl2OPurity:Min. 95%Color and Shape:PowderMolecular weight:253.91 g/mol






