
CAS 21900-54-9
:2-Chloro-4-fluorobenzoyl chloride
Description:
2-Chloro-4-fluorobenzoyl chloride is an organic compound characterized by its aromatic structure, which includes a benzoyl group substituted with both a chlorine and a fluorine atom. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a useful intermediate in organic synthesis, especially in the preparation of various pharmaceuticals and agrochemicals. The chlorine and fluorine substituents can influence the compound's electronic properties and reactivity, making it valuable in designing molecules with specific characteristics. 2-Chloro-4-fluorobenzoyl chloride is also sensitive to moisture and should be handled with care, as it can hydrolyze to form the corresponding carboxylic acid. Proper safety precautions, including the use of personal protective equipment, are essential when working with this compound due to its potential hazards.
Formula:C7H3Cl2FO
InChI:InChI=1/C7H3Cl2FO/c8-6-3-4(10)1-2-5(6)7(9)11/h1-3H
SMILES:c1cc(c(cc1F)Cl)C(=O)Cl
Synonyms:- 2-Chloro-4-fluorobenzene-1-carbonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-4-fluorobenzoyl chloride
CAS:2-Chloro-4-fluorobenzoyl chlorideFormula:C7H3Cl2FOPurity:98%Color and Shape: clear. colourless liquidMolecular weight:193.00g/mol2-Chloro-4-fluorobenzoyl Chloride
CAS:Formula:C7H3Cl2FOPurity:>98.0%(GC)(T)Color and Shape:White or Colorless to Light yellow powder to lump to clear liquidMolecular weight:193.002-Chloro-4-fluorobenzoyl chloride
CAS:Formula:C7H3Cl2FOPurity:95%Color and Shape:Low Melting SolidMolecular weight:1932-Chloro-4-fluorobenzoyl chloride
CAS:2-Chloro-4-fluorobenzoyl chloride is a chemical compound. It is a chlorinating agent that can react with an alcohol to produce the corresponding chloroformate. 2-Chloro-4-fluorobenzoyl chloride has shown antitumor activity in research, but has not yet been used clinically. This chemical may be useful for the treatment of cancers that are resistant to common chemotherapies such as chemotherapy and radiation therapy because it can produce a dihedral or cyclic spectrum with a fluorimetric detection range of 200 to 700 nm.Formula:C7H3Cl2FOPurity:Min. 95%Molecular weight:193 g/mol




