CAS 21902-34-1

2-chloro-4,6-bis(4-methylphenyl)-1,3,5-triazine

Description:

2-Chloro-4,6-bis(4-methylphenyl)-1,3,5-triazine, with the CAS number 21902-34-1, is an organic compound belonging to the triazine family, characterized by a six-membered aromatic ring containing three nitrogen atoms. This compound features a chlorine substituent at the 2-position and two para-substituted 4-methylphenyl groups at the 4 and 6 positions, contributing to its unique chemical properties. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The presence of the chlorine atom and the bulky methylphenyl groups can influence its reactivity, making it useful in various applications, including as a precursor in the synthesis of agrochemicals and pharmaceuticals. Additionally, its structure may impart specific electronic and steric properties, which can affect its behavior in chemical reactions and interactions with biological systems. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₇H₁₄ClN₃

InChI: InChI=1/C17H14ClN3/c1-11-3-7-13(8-4-11)15-19-16(21-17(18)20-15)14-9-5-12(2)6-10-14/h3-10H,1-2H3

SMILES: Cc1ccc(cc1)c1nc(c2ccc(C)cc2)nc(Cl)n1

Synonyms:

• 2-Chloro-4,6-Di-P-Tolyl-S-Triazine

2-Chloro-4,6-Di-P-Tolyl-1,3,5-Triazine

CAS: 21902-34-1

Formula: C₁₇H₁₄ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 295.7662

Ref: IN-DA01E6K8

2-Chloro-4,6-Di-P-Tolyl-1,3,5-Triazine

CAS: 21902-34-1

2-Chloro-4,6-Di-P-Tolyl-1,3,5-Triazine

Purity: 98%

Molecular weight: 295.77g/mol

Ref: 54-OR1010386

2-Chloro-4,6-di-p-tolyl-1,3,5-triazine

CAS: 21902-34-1

Formula: C₁₇H₁₄ClN₃

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 295.77

Ref: 3B-C3514

2-Chloro-4,6-di-p-tolyl-1,3,5-triazine

CAS: 21902-34-1

Purity: 95.0%

Molecular weight: 295.7699890136719

Ref: 10-F546193