CAS 21905-56-6
:Methyl 2-phenoxybenzoate
Description:
Methyl 2-phenoxybenzoate, with the CAS number 21905-56-6, is an organic compound that belongs to the class of esters. It is characterized by its aromatic structure, which includes a phenoxy group attached to a benzoate moiety. This compound typically appears as a colorless to pale yellow liquid with a pleasant, floral odor. Methyl 2-phenoxybenzoate is known for its solubility in organic solvents, such as ethanol and ether, while being less soluble in water. It is often utilized in the synthesis of various chemical compounds and may serve as a fragrance or flavoring agent in certain applications. Additionally, it can be involved in the production of agrochemicals and pharmaceuticals. The compound's properties, such as boiling point and melting point, can vary based on purity and environmental conditions. As with many organic compounds, safety precautions should be observed when handling methyl 2-phenoxybenzoate, as it may pose health risks if ingested or inhaled.
Formula:C14H12O3
InChI:InChI=1/C14H12O3/c1-16-14(15)12-9-5-6-10-13(12)17-11-7-3-2-4-8-11/h2-10H,1H3
SMILES:COC(=O)c1ccccc1Oc1ccccc1
Synonyms:- 2-Phenoxybenzoic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2-phenoxybenzoate, 99%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C14H12O3Purity:99%Molecular weight:228.25Methyl 2-phenoxybenzoate
CAS:Formula:C14H12O3Purity:98%Color and Shape:LiquidMolecular weight:228.2433
