CAS 21905-86-2

4-Cinnolinecarboxylic acid

Description:

4-Cinnolinecarboxylic acid, with the CAS number 21905-86-2, is an organic compound characterized by its cinnoline ring structure, which is a bicyclic compound containing a fused pyridine and pyrazole system. This compound features a carboxylic acid functional group (-COOH) at the 4-position of the cinnoline ring, contributing to its acidic properties. It is typically a crystalline solid that may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in the synthesis of other organic compounds. Its reactivity is influenced by the electron-withdrawing nature of the carboxylic acid group, which can participate in various chemical reactions, such as esterification and amidation. Additionally, 4-Cinnolinecarboxylic acid may serve as a building block for the development of pharmaceuticals or agrochemicals, highlighting its significance in chemical research and development.

Formula: C₉H₆N₂O₂

InChI: InChI=1S/C9H6N2O2/c12-9(13)7-5-10-11-8-4-2-1-3-6(7)8/h1-5H,(H,12,13)

InChI key: InChIKey=ZKOMQFDQFTVPBZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=NC1)C=CC=C2

Synonyms:

• 4-Cinnolinecarboxylic acid
• Nsc 75570
• Cinnoline-4-carboxylic acid

Cinnoline-4-carboxylic acid

CAS: 21905-86-2

Formula: C₉H₆N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 174.1561

Ref: IN-DA00C3VO

Cinnoline-4-carboxylic acid

CAS: 21905-86-2

Cinnoline-4-carboxylic acid

Purity: 95%

Molecular weight: 174.16g/mol

Ref: 54-OR962973

Cinnoline-4-carboxylic acid

CAS: 21905-86-2

Formula: C₉H₆N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 174.159

Ref: 10-F224587

Cinnoline-4-carboxylic acid

CAS: 21905-86-2

Cinnoline-4-carboxylic acid is a synthetic compound that is used in the synthesis of cinnolines. It is synthesized from formaldehyde and cinnamic acid through a process called decarboxylation. This process produces two molecules of CO2 and one molecule of formic acid. Cinnoline-4-carboxylic acid is soluble in organic solvents such as formamide, chloroform, or ethyl acetate, but insoluble in water. The compound has been shown to exhibit dose-dependent effects on the growth of cell cultures and can be used to study the effect of drugs on cells. It also has been shown to inhibit an enzyme called ciliaris, which is involved in the production of mucus by cells.

Formula: C₉H₆N₂O₂

Purity: Min. 95%

Molecular weight: 174.16 g/mol

Ref: 3D-WAA90586