CAS 21906-31-0
:2-Bromophenylacetone
Description:
2-Bromophenylacetone, with the CAS number 21906-31-0, is an organic compound characterized by its structure, which includes a bromine atom attached to a phenyl group adjacent to an acetone moiety. This compound typically appears as a colorless to pale yellow liquid and has a distinctive aromatic odor. It is known for its moderate solubility in organic solvents, such as ethanol and ether, while being less soluble in water due to its hydrophobic nature. The presence of the bromine atom contributes to its reactivity, making it useful in various chemical synthesis processes, including the production of pharmaceuticals and agrochemicals. Additionally, 2-Bromophenylacetone can undergo electrophilic substitution reactions, and its ketone functional group allows for further transformations in organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective equipment should be used.
Formula:C9H9BrO
InChI:InChI=1/C9H9BrO/c1-7(11)6-8-4-2-3-5-9(8)10/h2-5H,6H2,1H3
SMILES:CC(=O)Cc1ccccc1Br
Synonyms:- 1-(2-Bromophenyl)Propan-2-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Bromophenylacetone
CAS:Formula:C9H9BrOPurity:>98.0%(GC)Color and Shape:Light orange to Yellow to Green clear liquidMolecular weight:213.072-Bromophenylacetone
CAS:Controlled Product2-Bromophenylacetone is a reagent that is used to synthesize sulfonamides. It can be prepared by the reaction of phenylacetic acid with bromine in the presence of sodium hydroxide. The product can then be treated with sulfuric acid and hydrochloric acid to give 2-bromophenylacetone. This compound has been shown to have bacteriostatic activity against Gram-positive bacteria, as well as being an efficient method for synthesizing thiosemicarbazide.Formula:C9H9BrOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:213.07 g/mol2-Bromophenylacetone
CAS:Controlled ProductFormula:C9H9BrOColor and Shape:NeatMolecular weight:213.07





