CAS 21906-32-1
:3-Bromophenylacetone
Description:
3-Bromophenylacetone, with the CAS number 21906-32-1, is an organic compound characterized by its structure, which includes a bromine atom attached to a phenyl ring and an acetone moiety. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. This compound is known for its aromatic properties due to the presence of the phenyl group, which contributes to its reactivity and potential applications in organic synthesis. 3-Bromophenylacetone is often utilized as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. It exhibits moderate solubility in organic solvents, making it suitable for various chemical reactions. Additionally, it may possess certain biological activities, although specific toxicity and safety data should be consulted for handling and usage. As with many brominated compounds, it is important to consider environmental and health regulations when working with 3-Bromophenylacetone.
Formula:C9H9BrO
InChI:InChI=1/C9H9BrO/c1-7(11)5-8-3-2-4-9(10)6-8/h2-4,6H,5H2,1H3
SMILES:CC(=O)Cc1cccc(c1)Br
Synonyms:- 3-Bromophenylacetonone
- 1-(3-Bromophenyl)Propan-2-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(3-Bromophenyl)acetone
CAS:Controlled Product(3-Bromophenyl)acetone is a fine chemical that has many uses as an intermediate in organic synthesis, as a building block for complex compounds, and as a reagent. It is soluble in many organic solvents and can be used as a reaction component to produce other chemicals. This compound is stable at room temperature and has a high melting point of 149°C. (3-Bromophenyl)acetone is commercially available from suppliers around the world.Formula:C9H9BrOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:213.07 g/mol



