CAS 21911-67-1
:N-(3-Methylphenyl)glycine
Description:
N-(3-Methylphenyl)glycine, with the CAS number 21911-67-1, is an organic compound characterized by its structure, which includes a glycine moiety attached to a 3-methylphenyl group. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar solvents such as water and methanol, reflecting its polar functional groups. The presence of both an amino group and a carboxylic acid group in its structure allows it to exhibit properties typical of amino acids, including the ability to participate in hydrogen bonding and act as a zwitterion in solution. N-(3-Methylphenyl)glycine may be utilized in various applications, including pharmaceuticals and biochemical research, due to its potential role as a building block in the synthesis of more complex molecules. Its specific interactions and reactivity can vary based on the surrounding environment, making it a subject of interest in studies related to drug design and molecular biology.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-7-3-2-4-8(5-7)10-6-9(11)12/h2-5,10H,6H2,1H3,(H,11,12)
InChI key:InChIKey=MBNHCNDYGNYTMZ-UHFFFAOYSA-N
SMILES:N(CC(O)=O)C1=CC(C)=CC=C1
Synonyms:- Glycine, N-(3-methylphenyl)-
- 2-(3-Methylanilino)acetic acid
- 2-[(3-Methylphenyl)amino]acetic acid
- Glycine, N-m-tolyl-
- N-(3-Methylphenyl)glycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
[(3-Methylphenyl)amino]acetic acid
CAS:<p>[(3-Methylphenyl)amino]acetic acid is a high quality chemical that can be used as a reagent, intermediate, or building block in the synthesis of other compounds. It is useful for the synthesis of complex compounds and has been shown to have a wide range of applications. This compound can be used in research chemicals and as an intermediate in the production of fine chemicals. [(3-Methylphenyl)amino]acetic acid is a versatile building block that can be used to synthesize different types of molecules with diverse properties. It also has many potential uses in medicine as it has been shown to inhibit protein kinase C (PKC), which may provide therapeutic benefits for some diseases.</p>Formula:C9H11NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:165.19 g/mol
