CymitQuimica logo

CAS 21911-75-1

:

N-methyl-N-phenylglycine

Description:
N-methyl-N-phenylglycine, with the CAS number 21911-75-1, is an organic compound that belongs to the class of amino acids. It features a glycine backbone where one hydrogen atom is replaced by a methyl group and another by a phenyl group, resulting in a structure that combines both aliphatic and aromatic characteristics. This compound is typically a white to off-white crystalline solid and is soluble in polar solvents, reflecting its amino acid nature. N-methyl-N-phenylglycine exhibits properties typical of amino acids, such as the ability to participate in hydrogen bonding due to the presence of both an amine and a carboxylic acid functional group. It may also exhibit zwitterionic behavior, depending on the pH of the solution. This compound has potential applications in pharmaceuticals and biochemistry, particularly in the study of neurotransmitter systems and as a building block in peptide synthesis. Its unique structure allows for various interactions in biological systems, making it of interest in medicinal chemistry and drug design.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c1-10(7-9(11)12)8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,11,12)
InChI key:GYPHSVJFSAGJNQ-UHFFFAOYSA-N
SMILES:CN(CC(=O)O)c1ccccc1
Synonyms:
  • glycine, N-methyl-N-phenyl-
Found 5 products.