CymitQuimica logo

CAS 219121-62-7

:

2-phenylpyridin-3-amine hydrochloride

Description:
2-Phenylpyridin-3-amine hydrochloride is a chemical compound characterized by its pyridine ring structure substituted with both a phenyl group and an amino group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is common for hydrochloride salts. The presence of the amino group contributes to its basicity, while the phenyl group can influence its hydrophobic properties and interactions with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or enzymes. Its molecular structure allows for potential interactions in medicinal chemistry, and it may serve as a scaffold for further chemical modifications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C11H11ClN2
InChI:InChI=1/C11H10N2.ClH/c12-10-7-4-8-13-11(10)9-5-2-1-3-6-9;/h1-8H,12H2;1H
InChI key:WUUPIONDVKXCBK-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1c(cccn1)N.Cl
Synonyms:
  • 2-Phenylpyridin-3-amine hydrochloride (1:1)
  • 3-Pyridinamine, 2-phenyl-, hydrochloride (1:1)
Found 3 products.