
CAS 21913-87-1
:7-Hydroxy-1H-phenalen-1-one
Description:
7-Hydroxy-1H-phenalen-1-one, with the CAS number 21913-87-1, is an organic compound characterized by its polycyclic aromatic structure. It features a phenalenone backbone, which includes a hydroxyl group (-OH) at the 7-position, contributing to its chemical reactivity and potential biological activity. This compound is typically a yellow to orange solid and is soluble in organic solvents, reflecting its aromatic nature. It exhibits fluorescence properties, making it of interest in various applications, including organic electronics and photochemistry. The presence of the hydroxyl group can enhance its reactivity, allowing it to participate in hydrogen bonding and other interactions. Additionally, 7-Hydroxy-1H-phenalen-1-one may possess antioxidant properties, which could be relevant in pharmacological studies. Its unique structure and properties make it a subject of interest in both synthetic organic chemistry and materials science. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C13H8O2
InChI:InChI=1S/C13H8O2/c14-11-6-4-8-2-1-3-9-12(15)7-5-10(11)13(8)9/h1-7,15H
InChI key:InChIKey=BESDIAJTHBDPFY-UHFFFAOYSA-N
SMILES:O=C1C2=C3C(=C(O)C=C2)C=CC=C3C=C1
Synonyms:- 7-Hydroxy-1H-phenalen-1-one
- 1H-Phenalen-1-one, 7-hydroxy-
- Phenalen-1-one, 7-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.