CAS 219132-89-5

4-(3-Methyl-1-piperazinyl)benzenamine

Description:

4-(3-Methyl-1-piperazinyl)benzenamine, with the CAS number 219132-89-5, is an organic compound characterized by its aromatic amine structure. It features a benzene ring substituted with an amino group and a piperazine moiety, which is further substituted with a methyl group. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The piperazine ring contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the methyl group on the piperazine can influence the compound's lipophilicity and overall pharmacokinetic properties. Additionally, the compound may exhibit basic properties due to the amine functional groups, allowing it to participate in various chemical reactions, including alkylation and acylation. Safety and handling precautions should be observed, as with many amines, due to potential toxicity and reactivity.

Formula: C₁₁H₁₇N₃

InChI: InChI=1S/C11H17N3/c1-9-8-14(7-6-13-9)11-4-2-10(12)3-5-11/h2-5,9,13H,6-8,12H2,1H3

InChI key: InChIKey=DJVJJFDZNRYSHR-UHFFFAOYSA-N

SMILES: CC1CN(CCN1)C2=CC=C(N)C=C2

Synonyms:

• Benzenamine, 4-(3-methyl-1-piperazinyl)-
• 4-(3-Methyl-1-piperazinyl)benzenamine