CAS 219138-04-2
:Hexadecyl 9,12-octadecadienoate
Description:
Hexadecyl 9,12-octadecadienoate, also known as hexadecyl linoleate, is an ester derived from hexadecanol and linoleic acid. This compound features a long hydrophobic hydrocarbon chain, which contributes to its surfactant properties, making it useful in various applications, including cosmetics and pharmaceuticals. It is characterized by its unsaturated fatty acid component, which contains two double bonds in the 9 and 12 positions of the carbon chain, imparting fluidity and flexibility to the molecule. The presence of the hexadecyl group enhances its lipophilicity, allowing it to interact effectively with lipid membranes. Hexadecyl 9,12-octadecadienoate is typically a colorless to pale yellow liquid or solid, depending on the temperature, and is soluble in organic solvents while being insoluble in water. Its stability can be influenced by factors such as temperature and exposure to light, which may lead to oxidation. Overall, this compound's unique structure and properties make it valuable in formulations that require emulsification and stabilization of oil-water mixtures.
Formula:C34H64O2
InChI:InChI=1S/C34H64O2/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34(35)36-33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h11,13,17,19H,3-10,12,14-16,18,20-33H2,1-2H3
InChI key:InChIKey=MJCPRFASSBVGQD-UHFFFAOYSA-N
SMILES:C(C(OCCCCCCCCCCCCCCCC)=O)CCCCCCC=CCC=CCCCCC
Synonyms:- Hexadecyl 9,12-octadecadienoate
- 9,12-Octadecadienoic acid, hexadecyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Palmityl linoleate
CAS:Palmityl linoleate is a specialized ester, a compound resulting from the reaction between palmityl alcohol and linoleic acid. It is derived from natural sources, specifically palm oil and linseed oil, which provide the necessary fatty alcohol and essential fatty acid, respectively. The mode of action of palmityl linoleate involves its integration into lipid matrices, where it acts primarily as an emollient. This functionality is due to its ability to enhance the lipid barrier function of the epidermis, thus maintaining skin hydration and softness.Formula:C34H64O2Purity:Min. 95%Molecular weight:504.9 g/mol

