CAS 219138-21-3
:L-a-Asparagine,N-acetyl-L-isoleucyl-L-a-glutamyl-L-threonyl-N-(4-nitrophenyl)-
Description:
L-a-Asparagine, N-acetyl-L-isoleucyl-L-a-glutamyl-L-threonyl-N-(4-nitrophenyl)- is a synthetic peptide that incorporates several amino acid residues, including asparagine, isoleucine, glutamic acid, and threonine, along with a nitrophenyl group. This compound is characterized by its complex structure, which suggests potential applications in biochemistry and medicinal chemistry, particularly in drug design and development. The presence of the N-acetyl group may enhance its stability and solubility, while the nitrophenyl moiety could be involved in various biochemical interactions, possibly serving as a chromophore or a site for further chemical modification. The specific arrangement of amino acids contributes to its unique properties, influencing its biological activity and interactions with other molecules. As with many peptides, its behavior in solution, including solubility and stability, can be affected by factors such as pH and temperature. Overall, this compound exemplifies the intricate nature of peptide chemistry and its relevance in various scientific fields.
Formula:C27H38N6O12
InChI:InChI=1S/C27H38N6O12/c1-5-13(2)22(28-15(4)35)26(42)30-18(10-11-20(36)37)24(40)32-23(14(3)34)27(43)31-19(12-21(38)39)25(41)29-16-6-8-17(9-7-16)33(44)45/h6-9,13-14,18-19,22-23,34H,5,10-12H2,1-4H3,(H,28,35)(H,29,41)(H,30,42)(H,31,43)(H,32,40)(H,36,37)(H,38,39)/t13-,14+,18-,19-,22-,23-/m0/s1
InChI key:FHURKTIGZAIQGR-BQCLNCLCSA-N
SMILES:CC[C@H](C)[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(=O)O)C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)C
Synonyms:- Caspase-8 Substrate
- Caspase 8 Substrate 1, Chromogenic
- Caspase 8 Substrate 1M, Fluorogenic
- Caspase-8 Substrate I
- Caspase 8 Fluorometric Substrate
- Caspase-8 / Caspase-3 Processing Enzyme Substrate, Fluorogenic
- Caspase-8 / Caspase-3 Processing Enzyme Substrate (Chromogenic)
- Caspase-3 Processing Substrate Ii (Chromogenic)
- Ac-Ietd-Pna
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ac-Ile-Glu-Thr-Asp-pNA
CAS:Ac-Ile-Glu-Thr-Asp-PNA is a synthetic peptide that mimics the amino acid sequence of a region in the protein p67phox, which is a component of the mitochondrial membrane. Ac-Ile-Glu-Thr-Asp-PNA induces apoptosis by activating caspases and inhibiting ATP production. In vitro studies have shown this peptide to be active against hl60 cells, an inflammatory bowel disease cell line, as well as carcinoma cell lines derived from squamous cell carcinoma and carcinoma of the cervix. Ac-Ile-Glu-Thr-Asp-PNA also inhibits inflammatory cytokines such as IL1β, TNFα and IL6, which are associated with chronic inflammation.Formula:C27H38N6O12Purity:Min. 95%Molecular weight:638.62 g/mol



