CymitQuimica logo

CAS 21921-91-5

:

2-benzyl-N-methylbenzamide

Description:
2-Benzyl-N-methylbenzamide, with the CAS number 21921-91-5, is an organic compound characterized by its amide functional group, which is derived from benzamide. This compound features a benzyl group and a methyl group attached to the nitrogen atom of the amide, contributing to its structural complexity. It typically appears as a solid or liquid at room temperature, depending on its purity and specific conditions. The presence of aromatic rings in its structure often imparts notable stability and influences its solubility in organic solvents. 2-Benzyl-N-methylbenzamide may exhibit various chemical properties, including potential reactivity in nucleophilic substitution reactions due to the amide bond. Additionally, it may have applications in pharmaceuticals or as an intermediate in organic synthesis, owing to its unique structural features. Its physical and chemical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and usage guidelines.
Formula:C15H15NO
InChI:InChI=1/C15H15NO/c1-16-15(17)14-10-6-5-9-13(14)11-12-7-3-2-4-8-12/h2-10H,11H2,1H3,(H,16,17)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.