CymitQuimica logo

CAS 21926-01-2

:

2-aminopentane-1,5-diol

Description:
2-Aminopentane-1,5-diol, with the CAS number 21926-01-2, is an organic compound characterized by the presence of both amino and hydroxyl functional groups. It features a five-carbon chain (pentane) with an amino group (-NH2) attached to the second carbon and two hydroxyl groups (-OH) located at the first and fifth carbons. This structure imparts both hydrophilic and hydrophobic characteristics, making it soluble in water and potentially useful in various applications, including pharmaceuticals and biochemistry. The presence of the amino group allows for potential interactions in biological systems, while the hydroxyl groups can participate in hydrogen bonding, enhancing its reactivity. 2-Aminopentane-1,5-diol may also exhibit chirality, depending on the configuration of its substituents, which can influence its biological activity. Overall, its unique combination of functional groups makes it a compound of interest in synthetic organic chemistry and medicinal chemistry.
Formula:C5H13NO2
InChI:InChI=1/C5H13NO2/c6-5(4-8)2-1-3-7/h5,7-8H,1-4,6H2
SMILES:C(CC(CO)N)CO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.