CymitQuimica logo

CAS 21928-11-0

:

Benzoic acid, 4-[(dimethylamino)carbonyl]-, methyl ester

Description:
Benzoic acid, 4-[(dimethylamino)carbonyl]-, methyl ester, commonly referred to as a derivative of benzoic acid, is characterized by its ester functional group and the presence of a dimethylamino carbonyl substituent. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the dimethylamino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and acylation reactions. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c1-12(2)10(13)8-4-6-9(7-5-8)11(14)15-3/h4-7H,1-3H3
InChI key:PQPORQNZFWYDOI-UHFFFAOYSA-N
SMILES:CN(C)C(=O)C1=CC=C(C=C1)C(=O)OC
Found 3 products.