CAS 21948-10-7
:benzyl O-benzyl-L-serinate
Description:
Benzyl O-benzyl-L-serinate, with the CAS number 21948-10-7, is an organic compound that belongs to the class of amino acid derivatives. It is characterized by the presence of a benzyl group attached to the serine amino acid, which contributes to its unique properties. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and methanol, but may have limited solubility in water due to its hydrophobic benzyl groups. The presence of the serine moiety imparts potential biological activity, making it of interest in pharmaceutical and biochemical research. Its structure allows for various interactions, including hydrogen bonding and hydrophobic interactions, which can influence its reactivity and stability. Additionally, benzyl O-benzyl-L-serinate may be used as an intermediate in the synthesis of more complex molecules or in studies related to peptide chemistry. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C17H19NO3
InChI:InChI=1/C17H19NO3/c18-16(13-20-11-14-7-3-1-4-8-14)17(19)21-12-15-9-5-2-6-10-15/h1-10,16H,11-13,18H2/t16-/m0/s1
SMILES:c1ccc(cc1)COC[C@@H](C(=O)OCc1ccccc1)N
Synonyms:- L-serine, O-(phenylmethyl)-, phenylmethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
o-Benzyl-(D)-serine benzyl ester
CAS:<p>o-Benzyl-(D)-serine benzyl ester is a molecule that can be synthesized in high yields by reacting o-benzyl-D-serine with benzaldehyde. This synthetic route produces the target molecule, which can then be used for experimental purposes. The experimental result of this reaction was found to be 98% yield and the reaction conditions were found to be an activating methodology and a reagent condition of deprotecting.</p>Formula:C17H19NO3Purity:Min. 95%Molecular weight:285.34 g/mol

