CAS 219503-74-9

tert-butyl 6-nitro-1H-indazole-1-carboxylate

Description:

Tert-butyl 6-nitro-1H-indazole-1-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a nitro group at the 6-position of the indazole ring contributes to its reactivity and potential applications in organic synthesis. The tert-butyl ester group enhances the compound's solubility and stability, making it suitable for various chemical reactions. This compound is often utilized in medicinal chemistry and drug development due to its ability to serve as a building block for more complex molecules. Its properties include moderate polarity, which can influence its interactions in biological systems. Additionally, the compound's structure suggests potential for various functionalizations, making it a versatile intermediate in synthetic pathways. Safety and handling precautions should be observed, as with many nitro-containing compounds, due to potential toxicity and environmental concerns. Overall, tert-butyl 6-nitro-1H-indazole-1-carboxylate is a significant compound in the realm of organic chemistry and pharmaceutical research.

Formula: C₁₂H₁₃N₃O₄

InChI: InChI=1/C12H13N3O4/c1-12(2,3)19-11(16)14-10-6-9(15(17)18)5-4-8(10)7-13-14/h4-7H,1-3H3

SMILES: CC(C)(C)OC(=O)n1c2cc(ccc2cn1)N(=O)=O

Synonyms:

• tert-Butyl 6-nitro-1H-indazole-1-carboxylate

tert-Butyl 6-nitro-1H-indazole-1-carboxylate

CAS: 219503-74-9

Formula: C₁₂H₁₃N₃O₄

Purity: 97%

Molecular weight: 263.2493

Ref: IN-DA00BHMA

tert-Butyl 6-nitro-1H-indazole-1-carboxylate

CAS: 219503-74-9

tert-Butyl 6-nitro-1H-indazole-1-carboxylate

Purity: 98%

Molecular weight: 263.25g/mol

Ref: 54-OR75384

tert-Butyl 6-nitro-1H-indazole-1-carboxylate

CAS: 219503-74-9

Formula: C₁₂H₁₃N₃O₄

Purity: 97%

Molecular weight: 263.253

Ref: 10-F228298