CAS 21963-95-1
:1-(furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-3,4b,5,6,6a,7,8,10a,10b,11,12,12a-dodecahydro-1H-naphtho[2,1-f]isochromen-5-yl acetate
Description:
1-(Furan-3-yl)-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-3,4b,5,6,6a,7,8,10a,10b,11,12,12a-dodecahydro-1H-naphtho[2,1-f]isochromen-5-yl acetate, with CAS number 21963-95-1, is a complex organic compound characterized by its intricate polycyclic structure, which includes a fused naphthoisochromene framework. This compound features multiple methyl groups, contributing to its hydrophobic nature and potentially influencing its solubility and reactivity. The presence of a furan ring adds to its aromatic character, while the dioxo functional groups suggest potential reactivity in various chemical transformations. The acetate moiety indicates that it can undergo hydrolysis, releasing acetic acid under certain conditions. Such compounds may exhibit biological activity, making them of interest in medicinal chemistry and material science. Their structural complexity often leads to unique physical properties, such as specific melting and boiling points, as well as distinct spectral characteristics in techniques like NMR and IR spectroscopy. Overall, this compound exemplifies the rich diversity found in organic chemistry, particularly in the realm of polycyclic compounds.
Formula:C28H34O6
InChI:InChI=1/C28H34O6/c1-16(29)33-22-13-19-25(2,3)21(30)8-11-26(19,4)18-7-10-27(5)20(28(18,22)6)14-23(31)34-24(27)17-9-12-32-15-17/h8-9,11-12,14-15,18-19,22,24H,7,10,13H2,1-6H3
SMILES:CC(=O)OC1CC2C(C)(C)C(=O)C=CC2(C)C2CCC3(C)C(=CC(=O)OC3c3ccoc3)C12C
Synonyms:- (13α,17aα)-4,4,8-Trimethyl-7α-acetoxy-21,23-epoxy-D-homo-24-nor-17-oxa-5α-chola-1,14,20,22-tetrene-3,16-dione
- Deoxygedunin
- 3H-Phenanthro[2,1-c]pyran-3,8(4bH)-dione, 5-(acetyloxy)-1-(3-furanyl)-1,5,6,6a,7,10a,10b,11,12,12a-decahydro-4b,7,7,10a,12a-pentamethyl-, (1R,4bR,5R,6aR,10aR,10bR,12aR)-
- (13α,17aα)-7α-(Acetyloxy)-21,23-epoxy-4,4,8-trimethyl-D-homo-24-nor-17-oxa-5α-chola-1,14,20,22-tetrene-3,16-dione
- [(1R,4BR,5R,6AR,10AR,10BR,12AR)-1-(FURAN-3-YL)-4B,7,7,10A,12A-PENTAMETHYL-3,8-DIOXO-5,6,6A,10B,11,12-HEXAHYDRO-1H-NAPHTHO[2,1-F]ISOCHROMEN-5-YL] ACETATE
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Deoxygedunin
CAS:Deoxygedunin is a natural limonoid, which is a type of chemical compound often derived from plant sources, particularly in the Meliaceae family. This compound is primarily isolated from the seeds of the Indian neem tree (Azadirachta indica) and the African mahogany tree (Khaya senegalensis). It exhibits its biological effects through activation of the Nrf2 pathway, an essential cellular defense mechanism against oxidative stress. By promoting the expression of antioxidant proteins, deoxygedunin enhances cellular resilience to oxidative damage.
Formula:C28H34O6Purity:Min. 95%Molecular weight:466.57 g/mol
