CAS 219719-19-4

5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine

Description:

5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a quinoline moiety. The presence of the thiadiazole ring contributes to its potential biological activity, as thiadiazoles are known for their diverse pharmacological properties. The compound's molecular structure includes a thioether linkage, which can influence its reactivity and solubility. It is typically synthesized through specific organic reactions that involve the introduction of the quinoline group and the thiadiazole framework. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in medicinal chemistry. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. As with many heterocyclic compounds, the electronic properties imparted by the nitrogen and sulfur atoms in the ring systems can affect its interaction with biological targets. Overall, 5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine represents a class of compounds that are valuable for research in drug development and chemical biology.

Formula: C₁₂H₁₀N₄S₂

InChI: InChI=1/C12H10N4S2/c1-7-6-10(17-12-16-15-11(13)18-12)8-4-2-3-5-9(8)14-7/h2-6H,1H3,(H2,13,15)

SMILES: Cc1cc(c2ccccc2n1)Sc1n[nH]c(=N)s1

Synonyms:

• 5-[(2-Methylquinolin-4-Yl)Sulfanyl]-1,3,4-Thiadiazol-2-Amine

1,3,4-Thiadiazol-2-amine,5-[(2-methyl-4-quinolinyl)thio]-

CAS: 219719-19-4

Formula: C₁₂H₁₀N₄S₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 274.3646

Ref: IN-DA006Y84

5-[(2-Methylquinol-4-yl)thio]-1,3,4-thiadiazol-2-amine

CAS: 219719-19-4

5-[(2-Methylquinol-4-yl)thio]-1,3,4-thiadiazol-2-amine

Purity: ≥95%

Molecular weight: 274.36g/mol

Ref: 54-OR18400

5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine

CAS: 219719-19-4

Molecular weight: 274.3599853515625

Ref: 10-F518872