CAS 219770-56-6

Ethyl 4-[bis(phenylmethyl)amino]cyclohexanecarboxylate

Description:

Ethyl 4-[bis(phenylmethyl)amino]cyclohexanecarboxylate, identified by its CAS number 219770-56-6, is a chemical compound characterized by its unique structure, which includes a cyclohexane ring substituted with an ethyl ester and a bis(phenylmethyl)amino group. This compound typically exhibits properties associated with both amines and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The presence of the cyclohexane moiety contributes to its rigidity and steric hindrance, which can influence its biological activity and interaction with other molecules. Ethyl 4-[bis(phenylmethyl)amino]cyclohexanecarboxylate may be of interest in medicinal chemistry and drug development, particularly in the design of compounds with specific pharmacological properties. Its synthesis and characterization would involve standard organic chemistry techniques, and its applications could span various fields, including pharmaceuticals and materials science. However, specific safety and handling guidelines should be followed due to the potential hazards associated with its components.

Formula: C₂₃H₂₉NO₂

InChI: InChI=1S/C23H29NO2/c1-2-26-23(25)21-13-15-22(16-14-21)24(17-19-9-5-3-6-10-19)18-20-11-7-4-8-12-20/h3-12,21-22H,2,13-18H2,1H3

InChI key: InChIKey=FUHREEUSMVPWLY-UHFFFAOYSA-N

SMILES: N(CC1=CC=CC=C1)(CC2=CC=CC=C2)C3CCC(C(OCC)=O)CC3

Synonyms:

• Cyclohexanecarboxylic acid, 4-[bis(phenylmethyl)amino]-, ethyl ester
• Ethyl 4-(dibenzylamino)cyclohexanecarboxylate
• Ethyl 4-[bis(phenylmethyl)amino]cyclohexanecarboxylate

ETHYL 4-(DIBENZYLAMINO)CYCLOHEXANECARBOXYLATE

CAS: 219770-56-6

Formula: C₂₃H₂₉NO₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 351.49

Ref: 10-F390094