
CAS 2198-93-8
:Trichodermol
Description:
Trichodermol, with the CAS number 2198-93-8, is a chemical compound that is primarily known for its role as a natural product derived from certain fungi, particularly those in the genus Trichoderma. It is characterized by its structure as a sesquiterpene alcohol, which contributes to its biological activity. Trichodermol exhibits antifungal properties, making it of interest in agricultural and pharmaceutical applications. Its mechanism of action often involves disrupting the cell membranes of target organisms, thereby inhibiting their growth. Additionally, Trichodermol may have potential applications in biocontrol, as it can promote plant health by suppressing pathogenic fungi. The compound is typically studied for its ecological benefits and its role in sustainable agriculture. As with many natural products, the specific characteristics, such as solubility and stability, can vary based on environmental conditions and the presence of other compounds. Overall, Trichodermol represents a significant area of interest in both microbiology and agricultural chemistry.
Formula:C15H22O3
InChI:InChI=1S/C15H22O3/c1-9-4-5-13(2)11(6-9)18-12-7-10(16)14(13,3)15(12)8-17-15/h6,10-12,16H,4-5,7-8H2,1-3H3/t10-,11-,12-,13+,14-,15+/m1/s1
InChI key:InChIKey=XSUVNTHNQMGPIL-LACSLYJWSA-N
SMILES:C[C@]12[C@@]3([C@](O[C@]4([C@]1(C)CCC(C)=C4)[H])(C[C@H]2O)[H])CO3
Synonyms:- Trichothec-9-en-4-ol, 12,13-epoxy-, (4β)-
- Spiro[2,5-methano-1-benzoxepin-10,2′-oxiran]-4-ol, 2β,3,4α,5,5a,6,7,9aα-octahydro-5β,5aα,8-trimethyl-
- Spiro[2,5-methano-1-benzoxepin-10,2′-oxirane], trichothec-9-en-4-ol deriv.
- Trichothec-9-en-4β-ol, 12,13-epoxy-
- (4β)-12,13-Epoxytrichothec-9-en-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Trichodermol
CAS:Trichodermol is a fungal sesquiterpene derived from the farnesyl diphosphate pathway.Formula:C15H22O3Color and Shape:SolidMolecular weight:250.33
