CAS 219846-31-8
:5-(3-Methoxyphenyl)-3-(5-methyl-1,2,4-oxadiazol-3-yl)-1,6-naphthyridin-2(1H)-one
Description:
5-(3-Methoxyphenyl)-3-(5-methyl-1,2,4-oxadiazol-3-yl)-1,6-naphthyridin-2(1H)-one is a chemical compound characterized by its complex structure, which includes a naphthyridine core, a methoxyphenyl group, and an oxadiazole moiety. This compound typically exhibits properties such as moderate to high solubility in organic solvents, depending on the specific functional groups present. It may demonstrate biological activity, potentially serving as a lead compound in pharmaceutical research, particularly in areas related to anti-cancer or anti-inflammatory agents. The presence of the oxadiazole ring can contribute to its pharmacological properties, as oxadiazoles are known for their diverse biological activities. Additionally, the methoxy group can influence the compound's electronic properties and reactivity. As with many organic compounds, its stability, reactivity, and interactions with other molecules can vary based on environmental conditions such as pH and temperature. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry and drug development.
Formula:C18H14N4O3
InChI:InChI=1S/C18H14N4O3/c1-10-20-17(22-25-10)14-9-13-15(21-18(14)23)6-7-19-16(13)11-4-3-5-12(8-11)24-2/h3-9H,1-2H3,(H,21,23)
InChI key:InChIKey=JQOFKKWHXGQABB-UHFFFAOYSA-N
SMILES:O=C1NC=2C(=C(N=CC2)C3=CC(OC)=CC=C3)C=C1C=4N=C(C)ON4
Synonyms:- 1,6-Naphthyridin-2(1H)-one, 5-(3-methoxyphenyl)-3-(5-methyl-1,2,4-oxadiazol-3-yl)-
- 3-(5-Methyl-1,2,4-oxadiazol-3-yl)-5-(3-methoxyphenyl)-1,6-naphthyridine-2(1H)-one
- Ac-3933
- Ave-3933
- Radequinil
- Sx-3933
- 5-(3-Methoxyphenyl)-3-(5-methyl-1,2,4-oxadiazol-3-yl)-1,6-naphthyridin-2(1H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Radequinil
CAS:<p>Radequinil is a linker that can be used as a pharmaceutical formulation to bind drugs to muscle. It has been shown to have the capability of binding to benzodiazepine receptors and c1-6 alkyl groups, which are found in many drugs. Radequinil binds selectively to the diluent component in reconstituted formulations and has been shown to increase the solubility of insoluble drugs in vitro. The drug binding ability of Radequinil has been tested on cholinesterase inhibitors and shown to exhibit an inhibitory effect on their pathogenic mechanism. Radequinil also binds with high affinity to amyloid proteins, which may help prevent or treat Alzheimer's disease.</p>Formula:C18H14N4O3Purity:Min. 95%Molecular weight:334.3 g/molRadequinil
CAS:<p>Radequinil is a benzodiazepine receptor partial inverse agonist. Rade quinil binds to GABA(-) and GABA(+) ligand (Kis: 5.15 and 6.11 nM, respectively).</p>Formula:C18H14N4O3Purity:98%Color and Shape:SolidMolecular weight:334.33

