CAS 21987-21-3

12-Methyl-1-tridecanol

Description:

12-Methyl-1-tridecanol is a long-chain alcohol characterized by its molecular structure, which includes a straight-chain hydrocarbon backbone with a methyl group attached to the 12th carbon. This compound belongs to the class of fatty alcohols, which are typically derived from natural fats and oils. It is a colorless, viscous liquid at room temperature and is insoluble in water due to its hydrophobic nature, but it is soluble in organic solvents. The presence of the hydroxyl (-OH) functional group imparts some polar characteristics, allowing it to participate in hydrogen bonding. 12-Methyl-1-tridecanol is primarily used in the production of surfactants, emulsifiers, and as a lubricant in various industrial applications. Its relatively high molecular weight contributes to its low volatility and stability under standard conditions. Additionally, it may exhibit mild antimicrobial properties, making it useful in cosmetic formulations. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₄H₃₀O

InChI: InChI=1S/C14H30O/c1-14(2)12-10-8-6-4-3-5-7-9-11-13-15/h14-15H,3-13H2,1-2H3

InChI key: InChIKey=ZXUOFCUEFQCKKH-UHFFFAOYSA-N

SMILES: C(CCCCCCCCO)CCC(C)C

Synonyms:

• 1-Tridecanol, 12-Methyl-
• 12-Methyl-1-tridecanol

12-Methyltridecanol

Controlled Product

CAS: 21987-21-3

Formula: C₁₄H₃₀O

Color and Shape: Neat

Molecular weight: 214.387

Ref: TR-M331170