CAS 21987-32-6

Methyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate

Description:

Methyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate, with the CAS number 21987-32-6, is a bicyclic organic compound characterized by its unique structure that includes a bicyclo[2.2.1]heptane framework and an ester functional group. This compound features a seven-membered ring system that incorporates an oxygen atom, contributing to its reactivity and potential applications in organic synthesis. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Methyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its properties, such as boiling point, melting point, and solubility, can vary based on the molecular interactions and the presence of functional groups. This compound may be of interest in medicinal chemistry and materials science due to its structural features, which can influence biological activity and material properties.

Formula: C₈H₁₂O₃

InChI: InChI=1S/C8H12O3/c1-10-8(9)6-4-5-2-3-7(6)11-5/h5-7H,2-4H2,1H3

InChI key: InChIKey=UYMKMUZNHJKUQB-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1C2OC(C1)CC2

Synonyms:

• Methyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate
• 7-Oxabicyclo[2.2.1]heptane-2-carboxylic acid, methyl ester

Methyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate

CAS: 21987-32-6

Versatile small molecule scaffold

Formula: C₈H₁₂O₃

Purity: Min. 95%

Molecular weight: 156.18 g/mol

Ref: 3D-WAA98732