CAS 219873-06-0
:4-Cyano-2-fluorobenzyl alcohol
Description:
4-Cyano-2-fluorobenzyl alcohol is an organic compound characterized by the presence of a cyano group (-CN) and a fluorine atom attached to a benzyl alcohol structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and fluorine, reflecting its functional groups. The cyano group contributes to the compound's polarity and potential reactivity, while the fluorine atom can influence its electronic properties and stability. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its state at room temperature. It may exhibit moderate solubility in polar solvents due to the hydroxyl (-OH) group of the alcohol, while the cyano and fluorine substituents can enhance its interaction with various chemical environments. 4-Cyano-2-fluorobenzyl alcohol may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its unique structural features that can facilitate further chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H6FNO
InChI:InChI=1/C8H6FNO/c9-8-3-6(4-10)1-2-7(8)5-11/h1-3,11H,5H2
SMILES:c1cc(CO)c(cc1C#N)F
Synonyms:- 3-Fluoro-4-(hydroxymethyl)benzonitrile
- 4-Cyano-2-florobenzyl alcohol
- 4-Cyano-2-fluorobenzyl alcohol ISO 9001:2015 REACH
- Benzonitrile, 3-fluoro-4-(hydroxymethyl)-
- 4-Cyano-2-fluorobenzyl alcohol
- 3-Fluoro-4-(hydroxymethyl)benzonitrile99+%
- 3-Fluoro-4-(hydroxyMethyl)-benzonitrile[4-cyano--2-fluorobenzyl alcohol
- 3-Fluoro-4-(hydroxymethyl)benzonitrile 97%
- Benzonitrile, 3-fluoro-4-(hydroxymethyl)- (9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Cyano-2-fluorobenzyl alcohol
CAS:Formula:C8H6FNOPurity:96%Color and Shape:SolidMolecular weight:151.13773-Fluoro-4-(hydroxymethyl)benzonitrile
CAS:3-Fluoro-4-(hydroxymethyl)benzonitrileFormula:C8H6FNOPurity:98%Color and Shape: faint/pale lemon/gold crystalline powderMolecular weight:151.14g/mol4-Cyano-2-fluorobenzyl alcohol
CAS:4-Cyano-2-fluorobenzyl alcohol is a reagent that is used to produce chlorine and hydrochloric acid. It is also used industrially in the production of potassium chloride, a compound that is used in fertilizers, animal feed supplements, and water treatment. 4-Cyano-2-fluorobenzyl alcohol reacts with chloride ions to form hypochlorous acid (HOCl), which then reacts with water to form hydrogen chloride gas. The reaction with fluoride ions leads to the formation of hydrofluoric acid (HF).Formula:C8H6FNOPurity:Min. 95%Color and Shape:White To Beige SolidMolecular weight:151.14 g/mol3-Fluoro-4-(hydroxymethyl)benzonitrile
CAS:Formula:C8H6FNOPurity:96%Color and Shape:SolidMolecular weight:151.14



