CAS 2199-45-3
:ethyl 4,5-dimethyl-1H-pyrrole-2-carboxylate
Description:
Ethyl 4,5-dimethyl-1H-pyrrole-2-carboxylate is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. This compound features two methyl groups at the 4 and 5 positions of the pyrrole ring, contributing to its unique properties and reactivity. The presence of the ethyl ester group at the 2 position enhances its solubility in organic solvents and may influence its reactivity in various chemical reactions. Ethyl 4,5-dimethyl-1H-pyrrole-2-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. The compound's structure allows for potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C9H13NO2
InChI:InChI=1/C9H13NO2/c1-4-12-9(11)8-5-6(2)7(3)10-8/h5,10H,4H2,1-3H3
SMILES:CCOC(=O)c1cc(C)c(C)[nH]1
Synonyms:- 1H-pyrrole-2-carboxylic acid, 4,5-dimethyl-, ethyl ester
- 4,5-Dimethyl-1H-pyrrole-2-carboxylic acid ethyl ester
- Ethyl 4,5-dimethyl-1H-pyrrole-2-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 4,5-dimethyl-1H-pyrrole-2-carboxylate
CAS:Formula:C9H13NO2Purity:95%Color and Shape:SolidMolecular weight:167.2050Ethyl 4,5-dimethyl-1H-pyrrole-2-carboxylate
CAS:Ethyl 4,5-dimethyl-1H-pyrrole-2-carboxylate
Purity:95%Molecular weight:167.21g/molEthyl 4,5-dimethyl-1H-pyrrole-2-carboxylate
CAS:Ethyl 4,5-dimethyl-1H-pyrrole-2-carboxylate is a minimal inhibitory concentration antibiotic that inhibits the growth of bacteria by binding to their ribosomes. It inhibits protein synthesis and cell division, which leads to bacterial death. The methyl ester form has been isolated from a number of plants, including Javanica.Formula:C9H13NO2Purity:Min. 95%Molecular weight:167.2 g/mol




