CAS 2199-50-0
:Ethyl 5-methyl-1H-pyrrole-3-carboxylate
Description:
Ethyl 5-methyl-1H-pyrrole-3-carboxylate, with the CAS number 2199-50-0, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an ethyl ester functional group and a methyl substituent at the 5-position of the pyrrole ring, contributing to its unique chemical properties. Ethyl 5-methyl-1H-pyrrole-3-carboxylate is typically a colorless to pale yellow liquid with a pleasant odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic characteristics. The compound is of interest in various fields, including organic synthesis and medicinal chemistry, as it can serve as a building block for more complex molecules. Its reactivity is influenced by the presence of the carboxylate group, which can participate in various chemical reactions, including esterification and nucleophilic substitutions. Safety precautions should be taken when handling this compound, as with many organic chemicals, to avoid potential health hazards.
Formula:C8H11NO2
InChI:InChI=1S/C8H11NO2/c1-3-11-8(10)7-4-6(2)9-5-7/h4-5,9H,3H2,1-2H3
InChI key:InChIKey=KCDURADJPCIWEU-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CNC(C)=C1
Synonyms:- 5-Methyl-1H-pyrrole-3-carboxylic acid ethyl ester
- 1H-Pyrrole-3-carboxylic acid, 5-methyl-, ethyl ester
- Ethyl 5-methyl-3-pyrrolecarboxylate
- Pyrrole-3-carboxylic acid, 5-methyl-, ethyl ester
- Ethyl 5-methyl-1H-pyrrole-3-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Pyrrole-3-carboxylic acid, 5-Methyl-, ethyl ester
CAS:Formula:C8H11NO2Purity:97%Color and Shape:SolidMolecular weight:153.1784Ethyl 5-methyl-1H-pyrrole-3-carboxylate
CAS:Ethyl 5-methyl-1H-pyrrole-3-carboxylatePurity:97%Molecular weight:153.18g/molEthyl 5-methyl-1H-pyrrole-3-carboxylate
CAS:Ethyl 5-methyl-1H-pyrrole-3-carboxylate is a corticotropin-releasing factor (CRF) antagonist that has been shown to be an effective treatment for anxiety and depression. CRF antagonists are structurally related to the endogenous peptide, CRF, which regulates the hypothalamic-pituitary-adrenal axis. Ethyl 5-methyl-1H-pyrrole-3-carboxylate binds to the CRF receptor and blocks its activity, thus inhibiting the release of corticotropin from the pituitary gland. It is a bicyclic molecule that is closely related to other analogs such as alniditan, with similar properties. The discovery process of ethyl 5-methyl-1H-pyrrole-3 carboxylate was based on the synthesis of analogs with different structural features in order to find compounds that have a greater affinity for CRF receptors thanFormula:C8H11NO2Purity:Min. 95%Molecular weight:153.18 g/mol



