CAS 2199-83-9: 6-Bromo-3-butyryl-2H-chromen-2-one

Description:6-Bromo-3-butyryl-2H-chromen-2-one, with the CAS number 2199-83-9, is a chemical compound belonging to the class of flavonoids, specifically a chromone derivative. This compound features a chromone backbone, characterized by a benzopyran structure, which is substituted at the 6-position with a bromine atom and at the 3-position with a butyryl group. The presence of the bromine atom introduces notable electrophilic properties, which can influence its reactivity and potential biological activity. The butyryl group contributes to the compound's lipophilicity, potentially affecting its solubility and interaction with biological membranes. 6-Bromo-3-butyryl-2H-chromen-2-one may exhibit various pharmacological properties, including anti-inflammatory, antioxidant, or antimicrobial activities, making it of interest in medicinal chemistry. Its structural features allow for potential modifications that could enhance its therapeutic efficacy or selectivity. As with many organic compounds, proper handling and safety measures should be observed due to its chemical nature and potential biological effects.

Formula:C₁₃H₁₁BrO₃

InChI:InChI=1/C13H11BrO3/c1-2-3-11(15)10-7-8-6-9(14)4-5-12(8)17-13(10)16/h4-7H,2-3H2,1H3

Synonyms:
6-bromo-3-butanoyl-2H-chromen-2-one

Found 3 products.

Product data	Purity	Price range	Estimated delivery
6-Bromo-3-butyryl-2H-chromen-2-one REF: IN-DA003N44CAS: 2199-83-9	- - -	To inquire	Mon 14 Apr 25
6-Bromo-3-butyryl-2H-chromen-2-one REF: 10-F771990CAS: 2199-83-9	98%	- - -	Discontinued product
6-Bromo-3-butyryl-2H-chromen-2-one REF: 3D-CAA19983CAS: 2199-83-9	Min. 95%	- - -	Discontinued product