CAS 219929-89-2

4-[(4-methylphenyl)sulfanyl]-3-nitrobenzoic acid

Description:

4-[(4-Methylphenyl)sulfanyl]-3-nitrobenzoic acid, with the CAS number 219929-89-2, is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a nitro group and a thioether group. The presence of the 4-methylphenyl group introduces hydrophobic characteristics, while the nitro group contributes to its electron-withdrawing properties, potentially influencing its reactivity and solubility in various solvents. This compound may exhibit acidic behavior due to the carboxylic acid functional group, allowing it to participate in acid-base reactions. Its thioether linkage can also impart unique chemical properties, such as increased stability and potential for further functionalization. The compound's molecular structure suggests potential applications in pharmaceuticals or materials science, where its specific interactions and reactivity could be harnessed. Additionally, the presence of both electron-donating and electron-withdrawing groups may affect its electronic properties, making it of interest for studies in organic synthesis and medicinal chemistry.

Formula: C₁₄H₁₁NO₄S

InChI: InChI=1/C14H11NO4S/c1-9-2-5-11(6-3-9)20-13-7-4-10(14(16)17)8-12(13)15(18)19/h2-8H,1H3,(H,16,17)

Synonyms:

• 4-[(4-Methylphenyl)sulfanyl]-3-nitrobenzoic acid
• 4-[(4-METHYLPHENYL)THIO]-3-NITROBENZOIC ACID
• benzoic acid, 4-[(4-methylphenyl)thio]-3-nitro-

4-[(4-methylphenyl)thio]-3-nitrobenzoic acid

CAS: 219929-89-2

4-[(4-methylphenyl)thio]-3-nitrobenzoic acid

Purity: ≥95%

Molecular weight: 289.31g/mol

Ref: 54-OR72582