CAS 219959-87-2
:N-Hydroxy-4-(9H-pyrido[3,4-b]indol-9-yl)benzenamine
Description:
N-Hydroxy-4-(9H-pyrido[3,4-b]indol-9-yl)benzenamine, with the CAS number 219959-87-2, is a chemical compound characterized by its complex structure, which includes a hydroxylamine functional group and a pyridoindole moiety. This compound typically exhibits properties associated with both aromatic amines and hydroxylamines, such as potential reactivity in electrophilic substitution reactions and the ability to participate in hydrogen bonding due to the presence of the hydroxyl group. The pyridoindole structure suggests potential biological activity, possibly influencing its interaction with biological targets. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research or pharmaceutical contexts. Additionally, the compound may exhibit specific spectral characteristics in techniques such as UV-Vis and NMR spectroscopy, aiding in its identification and characterization. Overall, N-Hydroxy-4-(9H-pyrido[3,4-b]indol-9-yl)benzenamine represents a unique entity in the realm of organic chemistry, with potential implications in medicinal chemistry and drug development.
Formula:C17H13N3O
InChI:InChI=1/C17H13N3O/c21-19-12-5-7-13(8-6-12)20-16-4-2-1-3-14(16)15-9-10-18-11-17(15)20/h1-11,19,21H
InChI key:InChIKey=LECLBYWFRKFHIQ-UHFFFAOYSA-N
SMILES:N(O)C1=CC=C(N2C=3C(C=4C2=CN=CC4)=CC=CC3)C=C1
Synonyms:- Benzenamine, N-hydroxy-4-(9H-pyrido(3,4-b)indol-9-yl)-
- N-Hydroxy-4-(9H-pyrido(3,4-b)indol-9-yl)benzenamine
- Hydorxyaminophenylnorharmane
- benzenaMine
- HydroxyaMinophenylnorharMan
- HYDROXYAMINOPHENYLNORHARMANE
- N-Hydroxy-4-(9H-pyrido[3,4-b]indol-9-yl)
- 9-(4'-HYDROXYAMINOPHENYL)-9H-PYRIDO[3,4-B]INDOLE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
9-(4'-Hydroxyaminophenyl)-9H-pyrido[3,4-b]indole
CAS:Controlled ProductApplications A N-hydroxy metabolite of APNH (aminophenylnorharman). A mutagenic compound.
References Totsuka, Y., et al.: Carcinogenesis, 19, 11, 1995 (1998), Sone, H., et al.: Cancer Res., 60, 5080 (2000), Kawamori, T., et al.: Cancer Lett.,163, 157 (2001),Formula:C17H13N3OColor and Shape:NeatMolecular weight:275.3
