CAS 219986-64-8
:3-(4-methylphenyl)-5-(trifluoromethyl)-1H-pyrazole
Description:
3-(4-Methylphenyl)-5-(trifluoromethyl)-1H-pyrazole, identified by its CAS number 219986-64-8, is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a 4-methylphenyl group and a trifluoromethyl group, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in agrochemicals or medicinal chemistry, particularly in the development of new drugs or as a building block in organic synthesis. Additionally, the presence of fluorine atoms often imparts stability and alters the reactivity of the compound, making it a subject of study in various chemical contexts. Safety and handling precautions should be observed, as with many fluorinated compounds, due to potential toxicity and environmental impact.
Formula:C11H9F3N2
InChI:InChI=1/C11H9F3N2/c1-7-2-4-8(5-3-7)9-6-10(16-15-9)11(12,13)14/h2-6H,1H3,(H,15,16)
SMILES:Cc1ccc(cc1)c1cc(C(F)(F)F)n[nH]1
Synonyms:- 1H-Pyrazole, 3-(4-methylphenyl)-5-(trifluoromethyl)-
- 1H-Pyrazole, 5-(4-methylphenyl)-3-(trifluoromethyl)-
- 5-(4-Methylphenyl)-3-(trifluoromethyl)-1H-pyrazole
- 5-(Trifluoromethyl)-3-P-Tolyl-1H-Pyrazole
- 3-(Trifluoromethyl)-5-P-Tolyl-1H-Pyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-(Trifluoromethyl)-3-p-tolyl-1H-pyrazole
CAS:Formula:C11H9F3N2Purity:97%Color and Shape:SolidMolecular weight:226.19783-(p-Tolyl)-5-(trifluoromethyl)-1H-pyrazole
CAS:3-(p-Tolyl)-5-(trifluoromethyl)-1H-pyrazolePurity:97%Molecular weight:226.2g/mol3-(Trifluoromethyl)-5-p-tolyl-1H-pyrazole
CAS:Formula:C11H9F3N2Purity:97%Color and Shape:SolidMolecular weight:226.2023-Trifluoromethyl-5-(p-tolyl)-1H-pyrazole
CAS:Controlled ProductStability Hygroscopic
Applications 3-Trifluoromethyl-5-(p-tolyl)-1H-pyrazole is an impurity of cyclooxygenase-2 (COX-2) inhibitor Celecoxib (C251000).
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Satyanarayana, U. et al.: J. Pharm. Biomed. Anal., 35, 951 (2004);Formula:C11H9F3N2Color and Shape:Off-WhiteMolecular weight:226.23-(4-Methylphenyl)-5-(trifluoromethyl)pyrazole
CAS:Please enquire for more information about 3-(4-Methylphenyl)-5-(trifluoromethyl)pyrazole including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C11H9F3N2Purity:Min. 95%Molecular weight:226.2 g/mol






